C21H22F2N2O3S — CID 2716833
3-[2-[4-(difluoromethoxy)phenyl]imino-4-(4-ethoxyphenyl)-1,3-thiazol-3-yl]propan-1-ol (PubChem CID 2716833) has the molecular formula C21H22F2N2O3S and a molecular weight of 420.48 g/mol. Its IUPAC name is 3-[2-[4-(difluoromethoxy)phenyl]imino-4-(4-ethoxyphenyl)-1,3-thiazol-3-yl]propan-1-ol.
| Compound Name | 3-[2-[4-(difluoromethoxy)phenyl]imino-4-(4-ethoxyphenyl)-1,3-thiazol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 2716833 |
| Molecular Formula | C21H22F2N2O3S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 3-[2-[4-(difluoromethoxy)phenyl]imino-4-(4-ethoxyphenyl)-1,3-thiazol-3-yl]propan-1-ol |
| SMILES | CCOc1ccc(-c2cs/c(=N\c3ccc(OC(F)F)cc3)n2CCCO)cc1 |
| InChI | InChI=1S/C21H22F2N2O3S/c1-2-27-17-8-4-15(5-9-17)19-14-29-21(25(19)12-3-13-26)24-16-6-10-18(11-7-16)28-20(22)23/h4-11,14,20,26H,2-3,12-13H2,1H3/b24-21- |
| InChIKey | VNFDCCURVQJQCP-FLFQWRMESA-N |
| XLogP | 4.83 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|