C18H17FN2OS — CID 693862
3-ethyl-4-(3-fluoro-4-methoxyphenyl)-N-phenyl-1,3-thiazol-2-imine (PubChem CID 693862) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-ethyl-4-(3-fluoro-4-methoxyphenyl)-N-phenyl-1,3-thiazol-2-imine.
| Compound Name | 3-ethyl-4-(3-fluoro-4-methoxyphenyl)-N-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 693862 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 3-ethyl-4-(3-fluoro-4-methoxyphenyl)-N-phenyl-1,3-thiazol-2-imine |
| SMILES | CCn1c(-c2ccc(OC)c(F)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C18H17FN2OS/c1-3-21-16(13-9-10-17(22-2)15(19)11-13)12-23-18(21)20-14-7-5-4-6-8-14/h4-12H,3H2,1-2H3/b20-18- |
| InChIKey | GOYJPZQMECJLBY-ZZEZOPTASA-N |
| XLogP | 4.62 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|