C22H25N3O3S2 — CID 122185244
4-[[3-cyclohexyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide (PubChem CID 122185244) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 4-[[3-cyclohexyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide.
| Compound Name | 4-[[3-cyclohexyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 122185244 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-[[3-cyclohexyl-4-(4-methoxyphenyl)-1,3-thiazol-2-ylidene]amino]benzenesulfonamide |
| SMILES | COc1ccc(-c2cs/c(=N\c3ccc(S(N)(=O)=O)cc3)n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-28-19-11-7-16(8-12-19)21-15-29-22(25(21)18-5-3-2-4-6-18)24-17-9-13-20(14-10-17)30(23,26)27/h7-15,18H,2-6H2,1H3,(H2,23,26,27)/b24-22- |
| InChIKey | IKGASMNOEDXJEV-GYHWCHFESA-N |
| XLogP | 4.61 |
| TPSA | 86.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|