C23H20N4OS — CID 42598478
N-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]pyridine-2-carboximidamide (PubChem CID 42598478) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]pyridine-2-carboximidamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 42598478 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(/N=c1\scc(-c2ccc(OCC)cc2)n1-c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C23H20N4OS/c1-2-28-19-13-11-17(12-14-19)21-16-29-23(27(21)18-8-4-3-5-9-18)26-22(24)20-10-6-7-15-25-20/h3-16,24H,2H2,1H3/b24-22+,26-23- |
| InChIKey | XDHQZZRXMFMYRD-NZYVXWGSSA-N |
| XLogP | 4.93 |
| TPSA | 63.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|