C23H20N2O2S — CID 3743621
N,3-bis(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-imine (PubChem CID 3743621) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N,3-bis(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-imine.
| Compound Name | N,3-bis(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 3743621 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N,3-bis(4-methoxyphenyl)-4-phenyl-1,3-thiazol-2-imine |
| SMILES | COc1ccc(/N=c2\scc(-c3ccccc3)n2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-26-20-12-8-18(9-13-20)24-23-25(19-10-14-21(27-2)15-11-19)22(16-28-23)17-6-4-3-5-7-17/h3-16H,1-2H3/b24-23- |
| InChIKey | ICNKNPGMDHNROE-VHXPQNKSSA-N |
| XLogP | 5.46 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|