C15H12N2OS3 — CID 57148854
5-(4-methoxyphenyl)imino-4-phenyl-1,2,4-dithiazolidine-3-thione (PubChem CID 57148854) has the molecular formula C15H12N2OS3 and a molecular weight of 332.48 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)imino-4-phenyl-1,2,4-dithiazolidine-3-thione.
| Compound Name | 5-(4-methoxyphenyl)imino-4-phenyl-1,2,4-dithiazolidine-3-thione |
|---|---|
| PubChem CID | 57148854 |
| Molecular Formula | C15H12N2OS3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-(4-methoxyphenyl)imino-4-phenyl-1,2,4-dithiazolidine-3-thione |
| SMILES | COc1ccc(/N=c2\ssc(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2OS3/c1-18-13-9-7-11(8-10-13)16-14-17(15(19)21-20-14)12-5-3-2-4-6-12/h2-10H,1H3/b16-14- |
| InChIKey | JQEUKFNXFWIRLS-PEZBUJJGSA-N |
| XLogP | 4.57 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|