C13H19N3O — CID 171055873
N-(4-methoxyphenyl)-1,3-dimethyl-1,3-diazinan-2-imine (PubChem CID 171055873) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,3-dimethyl-1,3-diazinan-2-imine.
| Compound Name | N-(4-methoxyphenyl)-1,3-dimethyl-1,3-diazinan-2-imine |
|---|---|
| PubChem CID | 171055873 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | N-(4-methoxyphenyl)-1,3-dimethyl-1,3-diazinan-2-imine |
| SMILES | COc1ccc(N=C2N(C)CCCN2C)cc1 |
| InChI | InChI=1S/C13H19N3O/c1-15-9-4-10-16(2)13(15)14-11-5-7-12(17-3)8-6-11/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | HJOJETDRILYXOS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|