C22H27N5OS — CID 15125473
3-ethyl-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazol-2-imine (PubChem CID 15125473) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 3-ethyl-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazol-2-imine.
| Compound Name | 3-ethyl-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 15125473 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 3-ethyl-N-[4-[4-(4-methoxyphenyl)piperazin-1-yl]phenyl]-5-methyl-1,3,4-thiadiazol-2-imine |
| SMILES | CCn1nc(C)s/c1=N\c1ccc(N2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N5OS/c1-4-27-22(29-17(2)24-27)23-18-5-7-19(8-6-18)25-13-15-26(16-14-25)20-9-11-21(28-3)12-10-20/h5-12H,4,13-16H2,1-3H3/b23-22- |
| InChIKey | ZVXYBCKHZWTRDU-FCQUAONHSA-N |
| XLogP | 3.84 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|