C20H23N3O3S — CID 121081718
4,7-dimethoxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 121081718) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 4,7-dimethoxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 4,7-dimethoxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 121081718 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4,7-dimethoxy-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(N2CCN(c3nc4c(OC)ccc(OC)c4s3)CC2)cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-24-15-6-4-14(5-7-15)22-10-12-23(13-11-22)20-21-18-16(25-2)8-9-17(26-3)19(18)27-20/h4-9H,10-13H2,1-3H3 |
| InChIKey | ZOZDWKLXZVEYOE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|