C19H20FN3O2S — CID 121081717
2-[4-(2-fluorophenyl)piperazin-1-yl]-4,7-dimethoxy-1,3-benzothiazole (PubChem CID 121081717) has the molecular formula C19H20FN3O2S and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-4,7-dimethoxy-1,3-benzothiazole.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-4,7-dimethoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 121081717 |
| Molecular Formula | C19H20FN3O2S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-4,7-dimethoxy-1,3-benzothiazole |
| SMILES | COc1ccc(OC)c2sc(N3CCN(c4ccccc4F)CC3)nc12 |
| InChI | InChI=1S/C19H20FN3O2S/c1-24-15-7-8-16(25-2)18-17(15)21-19(26-18)23-11-9-22(10-12-23)14-6-4-3-5-13(14)20/h3-8H,9-12H2,1-2H3 |
| InChIKey | QYGQSZVMGKVGAE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |