C12H13ClN2O2 — CID 177393210
(5Z)-5-(chloromethylidene)-N-(4-methoxyphenyl)-3-methyl-1,3-oxazolidin-2-imine (PubChem CID 177393210) has the molecular formula C12H13ClN2O2 and a molecular weight of 252.70 g/mol. Its IUPAC name is (5Z)-5-(chloromethylidene)-N-(4-methoxyphenyl)-3-methyl-1,3-oxazolidin-2-imine.
| Compound Name | (5Z)-5-(chloromethylidene)-N-(4-methoxyphenyl)-3-methyl-1,3-oxazolidin-2-imine |
|---|---|
| PubChem CID | 177393210 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | (5Z)-5-(chloromethylidene)-N-(4-methoxyphenyl)-3-methyl-1,3-oxazolidin-2-imine |
| SMILES | COc1ccc(/N=C2\O/C(=C\Cl)CN2C)cc1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-15-8-11(7-13)17-12(15)14-9-3-5-10(16-2)6-4-9/h3-7H,8H2,1-2H3/b11-7-,14-12- |
| InChIKey | HMDVWESGHKCVOA-QUGLMBAUSA-N |
| XLogP | 2.72 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|