C9H8Cl3NO — CID 584090
2,2,2-trichloro-N-(4-methoxyphenyl)ethanimine (PubChem CID 584090) has the molecular formula C9H8Cl3NO and a molecular weight of 252.53 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4-methoxyphenyl)ethanimine.
| Compound Name | 2,2,2-trichloro-N-(4-methoxyphenyl)ethanimine |
|---|---|
| PubChem CID | 584090 |
| Molecular Formula | C9H8Cl3NO |
| Molecular Weight | 252.53 g/mol |
| Exact Mass | 250.97 |
| IUPAC Name | 2,2,2-trichloro-N-(4-methoxyphenyl)ethanimine |
| SMILES | COc1ccc(/N=C/C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H8Cl3NO/c1-14-8-4-2-7(3-5-8)13-6-9(10,11)12/h2-6H,1H3/b13-6+ |
| InChIKey | NUBYINQRVDTFPS-AWNIVKPZSA-N |
| XLogP | 3.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|