C22H20N2O4 — CID 136775481
3,6-bis[(4-methoxyphenyl)iminomethyl]benzene-1,2-diol (PubChem CID 136775481) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3,6-bis[(4-methoxyphenyl)iminomethyl]benzene-1,2-diol.
| Compound Name | 3,6-bis[(4-methoxyphenyl)iminomethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136775481 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3,6-bis[(4-methoxyphenyl)iminomethyl]benzene-1,2-diol |
| SMILES | COc1ccc(/N=C/c2ccc(/C=N/c3ccc(OC)cc3)c(O)c2O)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-27-19-9-5-17(6-10-19)23-13-15-3-4-16(22(26)21(15)25)14-24-18-7-11-20(28-2)12-8-18/h3-14,25-26H,1-2H3/b23-13+,24-14+ |
| InChIKey | OMUDETZXIAOBGV-RNIAWFEPSA-N |
| XLogP | 4.62 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|