C22H17NO4 — CID 135462299
10-[(4-methoxyphenyl)iminomethyl]anthracene-1,8,9-triol (PubChem CID 135462299) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 10-[(4-methoxyphenyl)iminomethyl]anthracene-1,8,9-triol.
| Compound Name | 10-[(4-methoxyphenyl)iminomethyl]anthracene-1,8,9-triol |
|---|---|
| PubChem CID | 135462299 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 10-[(4-methoxyphenyl)iminomethyl]anthracene-1,8,9-triol |
| SMILES | COc1ccc(/N=C/c2c3cccc(O)c3c(O)c3c(O)cccc23)cc1 |
| InChI | InChI=1S/C22H17NO4/c1-27-14-10-8-13(9-11-14)23-12-17-15-4-2-6-18(24)20(15)22(26)21-16(17)5-3-7-19(21)25/h2-12,24-26H,1H3/b23-12+ |
| InChIKey | MDHPEIRHKMJVQQ-FSJBWODESA-N |
| XLogP | 4.87 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|