About formyl chloride;1-methoxy-4-nitrosobenzene
formyl chloride;1-methoxy-4-nitrosobenzene (PubChem CID 178153567) has the molecular formula C8H8ClNO3
and a molecular weight of 201.61 g/mol. Its IUPAC name is formyl chloride;1-methoxy-4-nitrosobenzene.
Molecular Properties
| Compound Name | formyl chloride;1-methoxy-4-nitrosobenzene |
| PubChem CID | 178153567 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | formyl chloride;1-methoxy-4-nitrosobenzene |
| SMILES | COc1ccc(N=O)cc1.O=CCl |
| InChI | InChI=1S/C7H7NO2.CHClO/c1-10-7-4-2-6(8-9)3-5-7;2-1-3/h2-5H,1H3;1H |
| InChIKey | JWHLPHFXLYMEKO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formyl chloride;1-methoxy-4-nitrosobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyl chloride;1-methoxy-4-nitrosobenzene?
The IUPAC name of formyl chloride;1-methoxy-4-nitrosobenzene (CID 178153567) is formyl chloride;1-methoxy-4-nitrosobenzene.
What is the SMILES notation for formyl chloride;1-methoxy-4-nitrosobenzene?
The canonical SMILES for formyl chloride;1-methoxy-4-nitrosobenzene is COc1ccc(N=O)cc1.O=CCl.
What is the InChIKey of formyl chloride;1-methoxy-4-nitrosobenzene?
The InChIKey is JWHLPHFXLYMEKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.CHClO/c1-10-7-4-2-6(8-9)3-5-7;2-1-3/h2-5H,1H3;1H.
What are the key properties of formyl chloride;1-methoxy-4-nitrosobenzene?
formyl chloride;1-methoxy-4-nitrosobenzene has a molecular weight of 201.61 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formyl chloride;1-methoxy-4-nitrosobenzene is sourced from PubChem (CID 178153567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).