C12H17NO — CID 5197614
N-(4-methoxyphenyl)-2,2-dimethylpropan-1-imine (PubChem CID 5197614) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2,2-dimethylpropan-1-imine.
| Compound Name | N-(4-methoxyphenyl)-2,2-dimethylpropan-1-imine |
|---|---|
| PubChem CID | 5197614 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-(4-methoxyphenyl)-2,2-dimethylpropan-1-imine |
| SMILES | COc1ccc(/N=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H17NO/c1-12(2,3)9-13-10-5-7-11(14-4)8-6-10/h5-9H,1-4H3/b13-9+ |
| InChIKey | MSAMNPKWDUQXJR-UKTHLTGXSA-N |
| XLogP | 3.44 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|