C22H26N2OS — CID 155541067
(5Z)-N-(4-tert-butylphenyl)-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-2-imine (PubChem CID 155541067) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is (5Z)-N-(4-tert-butylphenyl)-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-2-imine.
| Compound Name | (5Z)-N-(4-tert-butylphenyl)-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 155541067 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (5Z)-N-(4-tert-butylphenyl)-5-[(4-methoxyphenyl)methylidene]-3-methyl-1,3-thiazolidin-2-imine |
| SMILES | COc1ccc(/C=C2/CN(C)/C(=N\c3ccc(C(C)(C)C)cc3)S2)cc1 |
| InChI | InChI=1S/C22H26N2OS/c1-22(2,3)17-8-10-18(11-9-17)23-21-24(4)15-20(26-21)14-16-6-12-19(25-5)13-7-16/h6-14H,15H2,1-5H3/b20-14-,23-21+ |
| InChIKey | JMQLDEMESVKIIP-GOOZCERISA-N |
| XLogP | 5.70 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|