C11H13NOSSe — CID 138974484
N-(4-methoxyphenyl)-1,3-thiaselenan-2-imine (PubChem CID 138974484) has the molecular formula C11H13NOSSe and a molecular weight of 286.26 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,3-thiaselenan-2-imine.
| Compound Name | N-(4-methoxyphenyl)-1,3-thiaselenan-2-imine |
|---|---|
| PubChem CID | 138974484 |
| Molecular Formula | C11H13NOSSe |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | N-(4-methoxyphenyl)-1,3-thiaselenan-2-imine |
| SMILES | COc1ccc(/N=C2\SCCC[Se]2)cc1 |
| InChI | InChI=1S/C11H13NOSSe/c1-13-10-5-3-9(4-6-10)12-11-14-7-2-8-15-11/h3-6H,2,7-8H2,1H3/b12-11+ |
| InChIKey | IJGDCNFMNSPTIB-VAWYXSNFSA-N |
| XLogP | 2.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|