C15H11N3O3 — CID 57270509
6-(4-methoxyphenyl)iminoquinoxaline-5,8-dione (PubChem CID 57270509) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)iminoquinoxaline-5,8-dione.
| Compound Name | 6-(4-methoxyphenyl)iminoquinoxaline-5,8-dione |
|---|---|
| PubChem CID | 57270509 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 6-(4-methoxyphenyl)iminoquinoxaline-5,8-dione |
| SMILES | COc1ccc(/N=C2\CC(=O)c3nccnc3C2=O)cc1 |
| InChI | InChI=1S/C15H11N3O3/c1-21-10-4-2-9(3-5-10)18-11-8-12(19)13-14(15(11)20)17-7-6-16-13/h2-7H,8H2,1H3/b18-11+ |
| InChIKey | FQZDNQZRLFDWDH-WOJGMQOQSA-N |
| XLogP | 2.03 |
| TPSA | 81.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|