C19H23NO2 — CID 12729570
4-(4-methoxyphenyl)imino-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-one (PubChem CID 12729570) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)imino-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-(4-methoxyphenyl)imino-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 12729570 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(4-methoxyphenyl)imino-2,6-di(propan-2-yl)cyclohexa-2,5-dien-1-one |
| SMILES | COc1ccc(N=C2C=C(C(C)C)C(=O)C(C(C)C)=C2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-12(2)17-10-15(11-18(13(3)4)19(17)21)20-14-6-8-16(22-5)9-7-14/h6-13H,1-5H3 |
| InChIKey | FEUAPOUVCVQSMZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|