C18H25N3O3 — CID 135589695
5-ethyl-2-(4-methoxyphenyl)imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-4,6-dione (PubChem CID 135589695) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-ethyl-2-(4-methoxyphenyl)imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-4,6-dione.
| Compound Name | 5-ethyl-2-(4-methoxyphenyl)imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 135589695 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-ethyl-2-(4-methoxyphenyl)imino-5-[(2S)-pentan-2-yl]-1,3-diazinane-4,6-dione |
| SMILES | CCC[C@H](C)C1(CC)C(=O)NC(=Nc2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C18H25N3O3/c1-5-7-12(3)18(6-2)15(22)20-17(21-16(18)23)19-13-8-10-14(24-4)11-9-13/h8-12H,5-7H2,1-4H3,(H2,19,20,21,22,23)/t12-/m0/s1 |
| InChIKey | DMEMNPJCDVLYPA-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|