C12H13BrOS2 — CID 11162896
2-bromo-3-(4-methoxyphenyl)-6,7-dihydro-5H-1,4-dithiepine (PubChem CID 11162896) has the molecular formula C12H13BrOS2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-bromo-3-(4-methoxyphenyl)-6,7-dihydro-5H-1,4-dithiepine.
| Compound Name | 2-bromo-3-(4-methoxyphenyl)-6,7-dihydro-5H-1,4-dithiepine |
|---|---|
| PubChem CID | 11162896 |
| Molecular Formula | C12H13BrOS2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2-bromo-3-(4-methoxyphenyl)-6,7-dihydro-5H-1,4-dithiepine |
| SMILES | COc1ccc(C2=C(Br)SCCCS2)cc1 |
| InChI | InChI=1S/C12H13BrOS2/c1-14-10-5-3-9(4-6-10)11-12(13)16-8-2-7-15-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | QSTOVMBMVVBHBC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |