C16H14O2S4 — CID 102027357
5,6-bis(4-methoxyphenyl)tetrathiine (PubChem CID 102027357) has the molecular formula C16H14O2S4 and a molecular weight of 366.55 g/mol. Its IUPAC name is 5,6-bis(4-methoxyphenyl)tetrathiine.
| Compound Name | 5,6-bis(4-methoxyphenyl)tetrathiine |
|---|---|
| PubChem CID | 102027357 |
| Molecular Formula | C16H14O2S4 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 5,6-bis(4-methoxyphenyl)tetrathiine |
| SMILES | COc1ccc(-c2ssssc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H14O2S4/c1-17-13-7-3-11(4-8-13)15-16(20-22-21-19-15)12-5-9-14(18-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | IPLYRQIXMIXWIY-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |