C22H18O2S — CID 14668872
1,3-bis(4-methoxyphenyl)-2-benzothiophene (PubChem CID 14668872) has the molecular formula C22H18O2S and a molecular weight of 346.45 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-2-benzothiophene.
| Compound Name | 1,3-bis(4-methoxyphenyl)-2-benzothiophene |
|---|---|
| PubChem CID | 14668872 |
| Molecular Formula | C22H18O2S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-2-benzothiophene |
| SMILES | COc1ccc(-c2sc(-c3ccc(OC)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H18O2S/c1-23-17-11-7-15(8-12-17)21-19-5-3-4-6-20(19)22(25-21)16-9-13-18(24-2)14-10-16/h3-14H,1-2H3 |
| InChIKey | FBJKRPSDEFNGRT-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |