C14H10BrNOS — CID 102442181
3-bromo-2-(4-methoxyphenyl)thieno[2,3-b]pyridine (PubChem CID 102442181) has the molecular formula C14H10BrNOS and a molecular weight of 320.21 g/mol. Its IUPAC name is 3-bromo-2-(4-methoxyphenyl)thieno[2,3-b]pyridine.
| Compound Name | 3-bromo-2-(4-methoxyphenyl)thieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 102442181 |
| Molecular Formula | C14H10BrNOS |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 3-bromo-2-(4-methoxyphenyl)thieno[2,3-b]pyridine |
| SMILES | COc1ccc(-c2sc3ncccc3c2Br)cc1 |
| InChI | InChI=1S/C14H10BrNOS/c1-17-10-6-4-9(5-7-10)13-12(15)11-3-2-8-16-14(11)18-13/h2-8H,1H3 |
| InChIKey | COHYXDWDLMHZHX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |