C24H14Br2N2OS — CID 177477395
7,18-dibromo-12-(4-methoxyphenyl)-11-thia-9,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,9,12,14(19),15,17-nonaene (PubChem CID 177477395) has the molecular formula C24H14Br2N2OS and a molecular weight of 538.26 g/mol. Its IUPAC name is 7,18-dibromo-12-(4-methoxyphenyl)-11-thia-9,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,9,12,14(19),15,17-nonaene.
| Compound Name | 7,18-dibromo-12-(4-methoxyphenyl)-11-thia-9,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,9,12,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 177477395 |
| Molecular Formula | C24H14Br2N2OS |
| Molecular Weight | 538.26 g/mol |
| Exact Mass | 535.92 |
| IUPAC Name | 7,18-dibromo-12-(4-methoxyphenyl)-11-thia-9,20-diazapentacyclo[11.7.0.02,10.03,8.014,19]icosa-1,3(8),4,6,9,12,14(19),15,17-nonaene |
| SMILES | COc1ccc(-c2sc3nc4c(Br)cccc4c-3c3[nH]c4c(Br)cccc4c23)cc1 |
| InChI | InChI=1S/C24H14Br2N2OS/c1-29-13-10-8-12(9-11-13)23-18-14-4-2-6-16(25)20(14)27-22(18)19-15-5-3-7-17(26)21(15)28-24(19)30-23/h2-11,27H,1H3 |
| InChIKey | WIOZNFYISXXRNS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.26 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |