C22H18N2O2S — CID 15076241
4,5-bis(4-methoxyphenyl)-2-pyridin-2-yl-1,3-thiazole (PubChem CID 15076241) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-pyridin-2-yl-1,3-thiazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-pyridin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 15076241 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-pyridin-2-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(-c3ccccn3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O2S/c1-25-17-10-6-15(7-11-17)20-21(16-8-12-18(26-2)13-9-16)27-22(24-20)19-5-3-4-14-23-19/h3-14H,1-2H3 |
| InChIKey | FIMFXNFDETVEMR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |