About 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline
4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline (PubChem CID 116885261) has the molecular formula C15H13N3S
and a molecular weight of 267.36 g/mol. Its IUPAC name is 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline.
Molecular Properties
| Compound Name | 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline |
| PubChem CID | 116885261 |
| Molecular Formula | C15H13N3S |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline |
| SMILES | Cc1nc(-c2ccccn2)sc1-c1ccc(N)cc1 |
| InChI | InChI=1S/C15H13N3S/c1-10-14(11-5-7-12(16)8-6-11)19-15(18-10)13-4-2-3-9-17-13/h2-9H,16H2,1H3 |
| InChIKey | YHVVXOFKNJZAON-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline?
The IUPAC name of 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline (CID 116885261) is 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline.
What is the SMILES notation for 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline?
The canonical SMILES for 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline is Cc1nc(-c2ccccn2)sc1-c1ccc(N)cc1.
What is the InChIKey of 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline?
The InChIKey is YHVVXOFKNJZAON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3S/c1-10-14(11-5-7-12(16)8-6-11)19-15(18-10)13-4-2-3-9-17-13/h2-9H,16H2,1H3.
What are the key properties of 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline?
4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline has a molecular weight of 267.36 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-2-pyridin-2-yl-1,3-thiazol-5-yl)aniline is sourced from PubChem (CID 116885261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).