C13H10N4S — CID 175286369
2,5-dipyridin-2-yl-1,3-thiazol-4-amine (PubChem CID 175286369) has the molecular formula C13H10N4S and a molecular weight of 254.32 g/mol. Its IUPAC name is 2,5-dipyridin-2-yl-1,3-thiazol-4-amine.
| Compound Name | 2,5-dipyridin-2-yl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 175286369 |
| Molecular Formula | C13H10N4S |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2,5-dipyridin-2-yl-1,3-thiazol-4-amine |
| SMILES | Nc1nc(-c2ccccn2)sc1-c1ccccn1 |
| InChI | InChI=1S/C13H10N4S/c14-12-11(9-5-1-3-7-15-9)18-13(17-12)10-6-2-4-8-16-10/h1-8H,14H2 |
| InChIKey | PKUVKNDSXDHJEF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |