C13H7F3N2S — CID 134103115
2-pyridin-2-yl-4-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 134103115) has the molecular formula C13H7F3N2S and a molecular weight of 280.27 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-(trifluoromethyl)-1,3-benzothiazole.
| Compound Name | 2-pyridin-2-yl-4-(trifluoromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 134103115 |
| Molecular Formula | C13H7F3N2S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-pyridin-2-yl-4-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)(F)c1cccc2sc(-c3ccccn3)nc12 |
| InChI | InChI=1S/C13H7F3N2S/c14-13(15,16)8-4-3-6-10-11(8)18-12(19-10)9-5-1-2-7-17-9/h1-7H |
| InChIKey | NXDBFVDDUIXYPK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |