2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid

C9H7N3O2S — CID 53271783

IUPAC2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid
SMILESNc1nc(C(=O)O)c(-c2ccccn2)s1
InChIInChI=1S/C9H7N3O2S/c10-9-12-6(8(13)14)7(15-9)5-3-1-2-4-11-5/h1-4H,(H2,10,12)(H,13,14)
InChIKeyBMJQGCMXTXAZGJ-UHFFFAOYSA-N
MW221.24 g/mol
LogP1.49
Rot. Bonds2

About 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid

2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 53271783) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid
PubChem CID53271783
Molecular FormulaC9H7N3O2S
Molecular Weight221.24 g/mol
Exact Mass221.03
IUPAC Name2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid
SMILESNc1nc(C(=O)O)c(-c2ccccn2)s1
InChIInChI=1S/C9H7N3O2S/c10-9-12-6(8(13)14)7(15-9)5-3-1-2-4-11-5/h1-4H,(H2,10,12)(H,13,14)
InChIKeyBMJQGCMXTXAZGJ-UHFFFAOYSA-N
XLogP1.49
TPSA89.10 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.24
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid (CID 53271783) is 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid is Nc1nc(C(=O)O)c(-c2ccccn2)s1.
What is the InChIKey of 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
The InChIKey is BMJQGCMXTXAZGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O2S/c10-9-12-6(8(13)14)7(15-9)5-3-1-2-4-11-5/h1-4H,(H2,10,12)(H,13,14).
What are the key properties of 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid?
2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid has a molecular weight of 221.24 g/mol, XLogP of 1.49, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 53271783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).