C9H7N3O2S — CID 53271783
2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 53271783) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 53271783 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2-amino-5-pyridin-2-yl-1,3-thiazole-4-carboxylic acid |
| SMILES | Nc1nc(C(=O)O)c(-c2ccccn2)s1 |
| InChI | InChI=1S/C9H7N3O2S/c10-9-12-6(8(13)14)7(15-9)5-3-1-2-4-11-5/h1-4H,(H2,10,12)(H,13,14) |
| InChIKey | BMJQGCMXTXAZGJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |