C43H33BrO2Si — CID 142700190
[20-bromo-3,15-bis(4-methoxyphenyl)-8-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),2,4(14),5(26),6,8,10,12,15,17(25),18,20,22-tridecaenyl]-trimethylsilane (PubChem CID 142700190) has the molecular formula C43H33BrO2Si and a molecular weight of 689.73 g/mol. Its IUPAC name is [20-bromo-3,15-bis(4-methoxyphenyl)-8-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),2,4(14),5(26),6,8,10,12,15,17(25),18,20,22-tridecaenyl]-trimethylsilane.
| Compound Name | [20-bromo-3,15-bis(4-methoxyphenyl)-8-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),2,4(14),5(26),6,8,10,12,15,17(25),18,20,22-tridecaenyl]-trimethylsilane |
|---|---|
| PubChem CID | 142700190 |
| Molecular Formula | C43H33BrO2Si |
| Molecular Weight | 689.73 g/mol |
| Exact Mass | 688.14 |
| IUPAC Name | [20-bromo-3,15-bis(4-methoxyphenyl)-8-heptacyclo[15.7.1.15,9.02,16.04,14.021,25.013,26]hexacosa-1(24),2,4(14),5(26),6,8,10,12,15,17(25),18,20,22-tridecaenyl]-trimethylsilane |
| SMILES | COc1ccc(-c2c3c4ccc(Br)c5cccc(c3c(-c3ccc(OC)cc3)c3c6ccc([Si](C)(C)C)c7cccc(c23)c76)c54)cc1 |
| InChI | InChI=1S/C43H33BrO2Si/c1-45-26-16-12-24(13-17-26)36-40-30-10-6-8-28-34(44)22-20-32(38(28)30)42(40)37(25-14-18-27(46-2)19-15-25)41-31-11-7-9-29-35(47(3,4)5)23-21-33(39(29)31)43(36)41/h6-23H,1-5H3 |
| InChIKey | MSHAYKVMTFEWSA-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.73 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|