C11H11NO2S — CID 170459034
[5-(4-methoxyphenyl)-1,3-thiazol-4-yl]methanol (PubChem CID 170459034) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is [5-(4-methoxyphenyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [5-(4-methoxyphenyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 170459034 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [5-(4-methoxyphenyl)-1,3-thiazol-4-yl]methanol |
| SMILES | COc1ccc(-c2scnc2CO)cc1 |
| InChI | InChI=1S/C11H11NO2S/c1-14-9-4-2-8(3-5-9)11-10(6-13)12-7-15-11/h2-5,7,13H,6H2,1H3 |
| InChIKey | UKWLXKAFFLSSPU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |