C10H8ClNOS — CID 170459033
[5-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol (PubChem CID 170459033) has the molecular formula C10H8ClNOS and a molecular weight of 225.70 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [5-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 170459033 |
| Molecular Formula | C10H8ClNOS |
| Molecular Weight | 225.70 g/mol |
| Exact Mass | 225.00 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1ncsc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClNOS/c11-8-3-1-7(2-4-8)10-9(5-13)12-6-14-10/h1-4,6,13H,5H2 |
| InChIKey | QLGKSCKOVYDYSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |