C5H7NO2S — CID 71467179
[5-(hydroxymethyl)-1,3-thiazol-4-yl]methanol (PubChem CID 71467179) has the molecular formula C5H7NO2S and a molecular weight of 145.18 g/mol. Its IUPAC name is [5-(hydroxymethyl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 71467179 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | [5-(hydroxymethyl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1ncsc1CO |
| InChI | InChI=1S/C5H7NO2S/c7-1-4-5(2-8)9-3-6-4/h3,7-8H,1-2H2 |
| InChIKey | PNPJTRKDLZMFBQ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |