C6H9NO2S3 — CID 142089231
4-(2-sulfanyloxyethyl)-5-(sulfanyloxymethyl)-1,3-thiazole (PubChem CID 142089231) has the molecular formula C6H9NO2S3 and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-(2-sulfanyloxyethyl)-5-(sulfanyloxymethyl)-1,3-thiazole.
| Compound Name | 4-(2-sulfanyloxyethyl)-5-(sulfanyloxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 142089231 |
| Molecular Formula | C6H9NO2S3 |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | 4-(2-sulfanyloxyethyl)-5-(sulfanyloxymethyl)-1,3-thiazole |
| SMILES | SOCCc1ncsc1COS |
| InChI | InChI=1S/C6H9NO2S3/c10-8-2-1-5-6(3-9-11)12-4-7-5/h4,10-11H,1-3H2 |
| InChIKey | XUFBVDRBQVCNKL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 31.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|