C20H21NO2S — CID 13015383
4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole (PubChem CID 13015383) has the molecular formula C20H21NO2S and a molecular weight of 339.46 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 13015383 |
| Molecular Formula | C20H21NO2S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-propan-2-yl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(C(C)C)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H21NO2S/c1-13(2)20-21-18(14-5-9-16(22-3)10-6-14)19(24-20)15-7-11-17(23-4)12-8-15/h5-13H,1-4H3 |
| InChIKey | FQDXHBDSPIMJQI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |