C22H23N3O3S2 — CID 54224136
N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-(1,3-thiazolidin-4-yl)methyl]formamide (PubChem CID 54224136) has the molecular formula C22H23N3O3S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-(1,3-thiazolidin-4-yl)methyl]formamide.
| Compound Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-(1,3-thiazolidin-4-yl)methyl]formamide |
|---|---|
| PubChem CID | 54224136 |
| Molecular Formula | C22H23N3O3S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-(1,3-thiazolidin-4-yl)methyl]formamide |
| SMILES | COc1ccc(-c2nc(C(NC=O)C3CSCN3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O3S2/c1-27-16-7-3-14(4-8-16)19-21(15-5-9-17(28-2)10-6-15)30-22(25-19)20(23-12-26)18-11-29-13-24-18/h3-10,12,18,20,24H,11,13H2,1-2H3,(H,23,26) |
| InChIKey | QERHDMDVTSCJHF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|