C22H24N2O2S — CID 8850714
N-cyclopentyl-4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 8850714) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-cyclopentyl-4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-cyclopentyl-4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 8850714 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-cyclopentyl-4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-c2nc(NC3CCCC3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-25-18-11-7-15(8-12-18)20-21(16-9-13-19(26-2)14-10-16)27-22(24-20)23-17-5-3-4-6-17/h7-14,17H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | PDFZYWVYJYBMQH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |