C26H31N5OS — CID 143376475
N-cyclohexyl-4-[2-(4-iminocyclohexyl)-4-(4-methoxyphenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine (PubChem CID 143376475) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-(4-iminocyclohexyl)-4-(4-methoxyphenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-cyclohexyl-4-[2-(4-iminocyclohexyl)-4-(4-methoxyphenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143376475 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | N-cyclohexyl-4-[2-(4-iminocyclohexyl)-4-(4-methoxyphenyl)-1,3-thiazol-5-yl]pyrimidin-2-amine |
| SMILES | [H]N=C1CCC(c2nc(-c3ccc(OC)cc3)c(-c3ccnc(NC4CCCCC4)n3)s2)CC1 |
| InChI | InChI=1S/C26H31N5OS/c1-32-21-13-9-17(10-14-21)23-24(33-25(31-23)18-7-11-19(27)12-8-18)22-15-16-28-26(30-22)29-20-5-3-2-4-6-20/h9-10,13-16,18,20,27H,2-8,11-12H2,1H3,(H,28,29,30)/b27-19- |
| InChIKey | XYNIFGHDXXQSHP-DIBXZPPDSA-N |
| XLogP | 6.70 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|