C18H17NO2S2 — CID 13209670
4,5-bis(4-methoxyphenyl)-2-methylsulfanyl-1,3-thiazole (PubChem CID 13209670) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-2-methylsulfanyl-1,3-thiazole.
| Compound Name | 4,5-bis(4-methoxyphenyl)-2-methylsulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 13209670 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-2-methylsulfanyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(SC)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H17NO2S2/c1-20-14-8-4-12(5-9-14)16-17(23-18(19-16)22-3)13-6-10-15(21-2)11-7-13/h4-11H,1-3H3 |
| InChIKey | IIMNWGNVRRCJCA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |