C19H21ClN4O2S — CID 19757960
2-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]guanidine;hydrochloride (PubChem CID 19757960) has the molecular formula C19H21ClN4O2S and a molecular weight of 404.92 g/mol. Its IUPAC name is 2-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]guanidine;hydrochloride.
| Compound Name | 2-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 19757960 |
| Molecular Formula | C19H21ClN4O2S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]guanidine;hydrochloride |
| SMILES | COc1ccc(-c2nc(CN=C(N)N)sc2-c2ccc(OC)cc2)cc1.Cl |
| InChI | InChI=1S/C19H20N4O2S.ClH/c1-24-14-7-3-12(4-8-14)17-18(13-5-9-15(25-2)10-6-13)26-16(23-17)11-22-19(20)21;/h3-10H,11H2,1-2H3,(H4,20,21,22);1H |
| InChIKey | SJQDBDQPCOJWGQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|