C19H20N4O2S — CID 57237222
1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-methylguanidine (PubChem CID 57237222) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-methylguanidine.
| Compound Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-methylguanidine |
|---|---|
| PubChem CID | 57237222 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)c1nc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C19H20N4O2S/c1-23(18(20)21)19-22-16(12-4-8-14(24-2)9-5-12)17(26-19)13-6-10-15(25-3)11-7-13/h4-11H,1-3H3,(H3,20,21) |
| InChIKey | XPQSGCDGOGHMQX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|