C22H25N5OS2 — CID 25197490
1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 25197490) has the molecular formula C22H25N5OS2 and a molecular weight of 439.61 g/mol. Its IUPAC name is 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25197490 |
| Molecular Formula | C22H25N5OS2 |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(-c3nnc(NC4CCCCC4)s3)cc2)cc1 |
| InChI | InChI=1S/C22H25N5OS2/c1-28-19-13-11-18(12-14-19)24-21(29)23-17-9-7-15(8-10-17)20-26-27-22(30-20)25-16-5-3-2-4-6-16/h7-14,16H,2-6H2,1H3,(H,25,27)(H2,23,24,29) |
| InChIKey | KAQDMHIPFZVGCG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 71.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|