C15H10F2N4S2 — CID 132524450
1-(4-fluorophenyl)-3-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]thiourea (PubChem CID 132524450) has the molecular formula C15H10F2N4S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]thiourea |
|---|---|
| PubChem CID | 132524450 |
| Molecular Formula | C15H10F2N4S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2nnc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C15H10F2N4S2/c16-10-3-1-9(2-4-10)13-20-21-15(23-13)19-14(22)18-12-7-5-11(17)6-8-12/h1-8H,(H2,18,19,21,22) |
| InChIKey | UMJWOLQGBOALAQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|