C16H21N5S2 — CID 25197356
1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-methylthiourea (PubChem CID 25197356) has the molecular formula C16H21N5S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-methylthiourea.
| Compound Name | 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-methylthiourea |
|---|---|
| PubChem CID | 25197356 |
| Molecular Formula | C16H21N5S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-[4-[5-(cyclohexylamino)-1,3,4-thiadiazol-2-yl]phenyl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc(-c2nnc(NC3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C16H21N5S2/c1-17-15(22)18-13-9-7-11(8-10-13)14-20-21-16(23-14)19-12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,19,21)(H2,17,18,22) |
| InChIKey | AOMRKHMENWHWEZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|