C13H14ClN3S — CID 6502471
5-(4-chlorophenyl)-N-cyclopentyl-1,3,4-thiadiazol-2-amine (PubChem CID 6502471) has the molecular formula C13H14ClN3S and a molecular weight of 279.80 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-cyclopentyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-chlorophenyl)-N-cyclopentyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 6502471 |
| Molecular Formula | C13H14ClN3S |
| Molecular Weight | 279.80 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N-cyclopentyl-1,3,4-thiadiazol-2-amine |
| SMILES | Clc1ccc(-c2nnc(NC3CCCC3)s2)cc1 |
| InChI | InChI=1S/C13H14ClN3S/c14-10-7-5-9(6-8-10)12-16-17-13(18-12)15-11-3-1-2-4-11/h5-8,11H,1-4H2,(H,15,17) |
| InChIKey | LPADVXMBXWPBSK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |