C11H20N4S — CID 82477350
5-(2-aminoethyl)-N-cycloheptyl-1,3,4-thiadiazol-2-amine (PubChem CID 82477350) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 5-(2-aminoethyl)-N-cycloheptyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-aminoethyl)-N-cycloheptyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 82477350 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5-(2-aminoethyl)-N-cycloheptyl-1,3,4-thiadiazol-2-amine |
| SMILES | NCCc1nnc(NC2CCCCCC2)s1 |
| InChI | InChI=1S/C11H20N4S/c12-8-7-10-14-15-11(16-10)13-9-5-3-1-2-4-6-9/h9H,1-8,12H2,(H,13,15) |
| InChIKey | DYQOWWRDCJVIHG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |