C15H29N5S — CID 135231942
N-[3-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]propyl]-N'-cyclohexylpropane-1,3-diamine (PubChem CID 135231942) has the molecular formula C15H29N5S and a molecular weight of 311.50 g/mol. Its IUPAC name is N-[3-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]propyl]-N'-cyclohexylpropane-1,3-diamine.
| Compound Name | N-[3-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]propyl]-N'-cyclohexylpropane-1,3-diamine |
|---|---|
| PubChem CID | 135231942 |
| Molecular Formula | C15H29N5S |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-[3-[5-(aminomethyl)-1,3,4-thiadiazol-2-yl]propyl]-N'-cyclohexylpropane-1,3-diamine |
| SMILES | NCc1nnc(CCCNCCCNC2CCCCC2)s1 |
| InChI | InChI=1S/C15H29N5S/c16-12-15-20-19-14(21-15)8-4-9-17-10-5-11-18-13-6-2-1-3-7-13/h13,17-18H,1-12,16H2 |
| InChIKey | XELCIXMFUWLZIY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|