C15H31N3 — CID 121321911
4-N-[3-(cyclohexylamino)propyl]cyclohexane-1,4-diamine (PubChem CID 121321911) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 4-N-[3-(cyclohexylamino)propyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[3-(cyclohexylamino)propyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 121321911 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 4-N-[3-(cyclohexylamino)propyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCCCNC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H31N3/c16-13-7-9-15(10-8-13)18-12-4-11-17-14-5-2-1-3-6-14/h13-15,17-18H,1-12,16H2 |
| InChIKey | XIVLUBFYZOUZEL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|